About 1,4-dibromo-2-ethoxybutane
1,4-dibromo-2-ethoxybutane (PubChem CID 19019599) has the molecular formula C6H12Br2O
and a molecular weight of 259.97 g/mol. Its IUPAC name is 1,4-dibromo-2-ethoxybutane.
Molecular Properties
| Compound Name | 1,4-dibromo-2-ethoxybutane |
| PubChem CID | 19019599 |
| Molecular Formula | C6H12Br2O |
| Molecular Weight | 259.97 g/mol |
| Exact Mass | 257.93 |
| IUPAC Name | 1,4-dibromo-2-ethoxybutane |
| SMILES | CCOC(CBr)CCBr |
| InChI | InChI=1S/C6H12Br2O/c1-2-9-6(5-8)3-4-7/h6H,2-5H2,1H3 |
| InChIKey | MURDKFZVSNTXIA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.97 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dibromo-2-ethoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibromo-2-ethoxybutane?
The IUPAC name of 1,4-dibromo-2-ethoxybutane (CID 19019599) is 1,4-dibromo-2-ethoxybutane.
What is the SMILES notation for 1,4-dibromo-2-ethoxybutane?
The canonical SMILES for 1,4-dibromo-2-ethoxybutane is CCOC(CBr)CCBr.
What is the InChIKey of 1,4-dibromo-2-ethoxybutane?
The InChIKey is MURDKFZVSNTXIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12Br2O/c1-2-9-6(5-8)3-4-7/h6H,2-5H2,1H3.
What are the key properties of 1,4-dibromo-2-ethoxybutane?
1,4-dibromo-2-ethoxybutane has a molecular weight of 259.97 g/mol, XLogP of 2.57, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibromo-2-ethoxybutane is sourced from PubChem (CID 19019599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).