C16H28O2 — CID 145008773
5-(2-ethoxyheptoxymethyl)cyclohexa-1,3-diene (PubChem CID 145008773) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 5-(2-ethoxyheptoxymethyl)cyclohexa-1,3-diene.
| Compound Name | 5-(2-ethoxyheptoxymethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 145008773 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 5-(2-ethoxyheptoxymethyl)cyclohexa-1,3-diene |
| SMILES | CCCCCC(COCC1C=CC=CC1)OCC |
| InChI | InChI=1S/C16H28O2/c1-3-5-7-12-16(18-4-2)14-17-13-15-10-8-6-9-11-15/h6,8-10,15-16H,3-5,7,11-14H2,1-2H3 |
| InChIKey | BPCGKMAPKKTHDX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|