C9H14O3 — CID 123894512
cyclohexa-2,4-dien-1-ylmethoxy(methoxy)methanol (PubChem CID 123894512) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-ylmethoxy(methoxy)methanol.
| Compound Name | cyclohexa-2,4-dien-1-ylmethoxy(methoxy)methanol |
|---|---|
| PubChem CID | 123894512 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | cyclohexa-2,4-dien-1-ylmethoxy(methoxy)methanol |
| SMILES | COC(O)OCC1C=CC=CC1 |
| InChI | InChI=1S/C9H14O3/c1-11-9(10)12-7-8-5-3-2-4-6-8/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | OZFDPHVEQJPBIY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|