About 7-propyltricyclo[4.2.0.02,5]octa-1(8),2(5),3-triene
7-propyltricyclo[4.2.0.02,5]octa-1(8),2(5),3-triene (PubChem CID 90927055) has the molecular formula C11H12
and a molecular weight of 144.22 g/mol. Its IUPAC name is 7-propyltricyclo[4.2.0.02,5]octa-1(8),2(5),3-triene.
Analyze 7-propyltricyclo[4.2.0.02,5]octa-1(8),2(5),3-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propyltricyclo[4.2.0.02,5]octa-1(8),2(5),3-triene?
The IUPAC name of 7-propyltricyclo[4.2.0.02,5]octa-1(8),2(5),3-triene (CID 90927055) is 7-propyltricyclo[4.2.0.02,5]octa-1(8),2(5),3-triene.
What is the SMILES notation for 7-propyltricyclo[4.2.0.02,5]octa-1(8),2(5),3-triene?
The canonical SMILES for 7-propyltricyclo[4.2.0.02,5]octa-1(8),2(5),3-triene is CCCC1C=C2C3=C(C=C3)C21.
What is the InChIKey of 7-propyltricyclo[4.2.0.02,5]octa-1(8),2(5),3-triene?
The InChIKey is ALUIOHHJPJIVMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12/c1-2-3-7-6-10-8-4-5-9(8)11(7)10/h4-7,11H,2-3H2,1H3.
What are the key properties of 7-propyltricyclo[4.2.0.02,5]octa-1(8),2(5),3-triene?
7-propyltricyclo[4.2.0.02,5]octa-1(8),2(5),3-triene has a molecular weight of 144.22 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propyltricyclo[4.2.0.02,5]octa-1(8),2(5),3-triene is sourced from PubChem (CID 90927055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).