C26H28N2O — CID 154935418
2-(4-hexylcyclohexa-2,4-dien-1-yl)-5-(4-phenylphenyl)-1,3,4-oxadiazole (PubChem CID 154935418) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-(4-hexylcyclohexa-2,4-dien-1-yl)-5-(4-phenylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(4-hexylcyclohexa-2,4-dien-1-yl)-5-(4-phenylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 154935418 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 2-(4-hexylcyclohexa-2,4-dien-1-yl)-5-(4-phenylphenyl)-1,3,4-oxadiazole |
| SMILES | CCCCCCC1=CCC(c2nnc(-c3ccc(-c4ccccc4)cc3)o2)C=C1 |
| InChI | InChI=1S/C26H28N2O/c1-2-3-4-6-9-20-12-14-23(15-13-20)25-27-28-26(29-25)24-18-16-22(17-19-24)21-10-7-5-8-11-21/h5,7-8,10-14,16-19,23H,2-4,6,9,15H2,1H3 |
| InChIKey | OKSUZJPMDBHHKB-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|