C24H22IN2O- — CID 143808738
2-[4-(4-butyliodanuidylphenyl)phenyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 143808738) has the molecular formula C24H22IN2O- and a molecular weight of 481.36 g/mol. Its IUPAC name is 2-[4-(4-butyliodanuidylphenyl)phenyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[4-(4-butyliodanuidylphenyl)phenyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 143808738 |
| Molecular Formula | C24H22IN2O- |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 2-[4-(4-butyliodanuidylphenyl)phenyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | CCCC[I-]c1ccc(-c2ccc(-c3nnc(-c4ccccc4)o3)cc2)cc1 |
| InChI | InChI=1S/C24H22IN2O/c1-2-3-17-25-22-15-13-19(14-16-22)18-9-11-21(12-10-18)24-27-26-23(28-24)20-7-5-4-6-8-20/h4-16H,2-3,17H2,1H3/q-1 |
| InChIKey | ASKYDSNVINAIID-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|