C21H30F2 — CID 67648693
1,5-difluoro-6-methyl-6-(4-octylcyclohexa-2,4-dien-1-yl)cyclohexa-1,3-diene (PubChem CID 67648693) has the molecular formula C21H30F2 and a molecular weight of 320.47 g/mol. Its IUPAC name is 1,5-difluoro-6-methyl-6-(4-octylcyclohexa-2,4-dien-1-yl)cyclohexa-1,3-diene.
| Compound Name | 1,5-difluoro-6-methyl-6-(4-octylcyclohexa-2,4-dien-1-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 67648693 |
| Molecular Formula | C21H30F2 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 1,5-difluoro-6-methyl-6-(4-octylcyclohexa-2,4-dien-1-yl)cyclohexa-1,3-diene |
| SMILES | CCCCCCCCC1=CCC(C2(C)C(F)=CC=CC2F)C=C1 |
| InChI | InChI=1S/C21H30F2/c1-3-4-5-6-7-8-10-17-13-15-18(16-14-17)21(2)19(22)11-9-12-20(21)23/h9,11-15,18-19H,3-8,10,16H2,1-2H3 |
| InChIKey | KMNJAYVIXPRWHI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|