C20H31NO2 — CID 162388144
N-[(Z)-5-(4-methylcyclohexa-1,5-dien-1-yl)-4-oxopent-2-enyl]octanamide (PubChem CID 162388144) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is N-[(Z)-5-(4-methylcyclohexa-1,5-dien-1-yl)-4-oxopent-2-enyl]octanamide.
| Compound Name | N-[(Z)-5-(4-methylcyclohexa-1,5-dien-1-yl)-4-oxopent-2-enyl]octanamide |
|---|---|
| PubChem CID | 162388144 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | N-[(Z)-5-(4-methylcyclohexa-1,5-dien-1-yl)-4-oxopent-2-enyl]octanamide |
| SMILES | CCCCCCCC(=O)NC/C=C\C(=O)CC1=CCC(C)C=C1 |
| InChI | InChI=1S/C20H31NO2/c1-3-4-5-6-7-10-20(23)21-15-8-9-19(22)16-18-13-11-17(2)12-14-18/h8-9,11,13-14,17H,3-7,10,12,15-16H2,1-2H3,(H,21,23)/b9-8- |
| InChIKey | DCLGCZWRAMNNKW-HJWRWDBZSA-N |
| XLogP | 4.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|