C23H31NO4S — CID 145369462
ethyl 2-[2-(5-octylcyclohepta-1,3,6-trien-1-yl)oxyacetyl]-1,3-thiazole-4-carboxylate (PubChem CID 145369462) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is ethyl 2-[2-(5-octylcyclohepta-1,3,6-trien-1-yl)oxyacetyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[2-(5-octylcyclohepta-1,3,6-trien-1-yl)oxyacetyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 145369462 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | ethyl 2-[2-(5-octylcyclohepta-1,3,6-trien-1-yl)oxyacetyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCCCCC1C=CC=C(OCC(=O)c2nc(C(=O)OCC)cs2)C=C1 |
| InChI | InChI=1S/C23H31NO4S/c1-3-5-6-7-8-9-11-18-12-10-13-19(15-14-18)28-16-21(25)22-24-20(17-29-22)23(26)27-4-2/h10,12-15,17-18H,3-9,11,16H2,1-2H3 |
| InChIKey | RENJZMBCKTTWDX-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|