C20H25NO5S — CID 118860408
methyl 2-[2-[4-(hexoxymethyl)phenoxy]acetyl]-1,3-thiazole-4-carboxylate (PubChem CID 118860408) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is methyl 2-[2-[4-(hexoxymethyl)phenoxy]acetyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[2-[4-(hexoxymethyl)phenoxy]acetyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 118860408 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | methyl 2-[2-[4-(hexoxymethyl)phenoxy]acetyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCCOCc1ccc(OCC(=O)c2nc(C(=O)OC)cs2)cc1 |
| InChI | InChI=1S/C20H25NO5S/c1-3-4-5-6-11-25-12-15-7-9-16(10-8-15)26-13-18(22)19-21-17(14-27-19)20(23)24-2/h7-10,14H,3-6,11-13H2,1-2H3 |
| InChIKey | FPUWQSLESYJQQC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|