C18H21NO3 — CID 143472467
methyl 6-[(4-butylphenoxy)methyl]pyridine-2-carboxylate (PubChem CID 143472467) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is methyl 6-[(4-butylphenoxy)methyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[(4-butylphenoxy)methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 143472467 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | methyl 6-[(4-butylphenoxy)methyl]pyridine-2-carboxylate |
| SMILES | CCCCc1ccc(OCc2cccc(C(=O)OC)n2)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-3-4-6-14-9-11-16(12-10-14)22-13-15-7-5-8-17(19-15)18(20)21-2/h5,7-12H,3-4,6,13H2,1-2H3 |
| InChIKey | YLXWRWVIHBLQHH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |