C12H8ClNO4S — CID 9159452
2-[2-(4-chlorophenoxy)acetyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 9159452) has the molecular formula C12H8ClNO4S and a molecular weight of 297.72 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)acetyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-(4-chlorophenoxy)acetyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 9159452 |
| Molecular Formula | C12H8ClNO4S |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)acetyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(C(=O)COc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C12H8ClNO4S/c13-7-1-3-8(4-2-7)18-5-10(15)11-14-9(6-19-11)12(16)17/h1-4,6H,5H2,(H,16,17) |
| InChIKey | RSIICWOZLZNPMH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |