C13H10NO4S- — CID 9159253
2-[2-(4-methylphenoxy)acetyl]-1,3-thiazole-4-carboxylate (PubChem CID 9159253) has the molecular formula C13H10NO4S- and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-[2-(4-methylphenoxy)acetyl]-1,3-thiazole-4-carboxylate.
| Compound Name | 2-[2-(4-methylphenoxy)acetyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 9159253 |
| Molecular Formula | C13H10NO4S- |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-[2-(4-methylphenoxy)acetyl]-1,3-thiazole-4-carboxylate |
| SMILES | Cc1ccc(OCC(=O)c2nc(C(=O)[O-])cs2)cc1 |
| InChI | InChI=1S/C13H11NO4S/c1-8-2-4-9(5-3-8)18-6-11(15)12-14-10(7-19-12)13(16)17/h2-5,7H,6H2,1H3,(H,16,17)/p-1 |
| InChIKey | IHWRJSHXQRXWLP-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 79.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |