C13H10NO5S- — CID 9159295
2-[2-(4-methoxyphenoxy)acetyl]-1,3-thiazole-4-carboxylate (PubChem CID 9159295) has the molecular formula C13H10NO5S- and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenoxy)acetyl]-1,3-thiazole-4-carboxylate.
| Compound Name | 2-[2-(4-methoxyphenoxy)acetyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 9159295 |
| Molecular Formula | C13H10NO5S- |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-[2-(4-methoxyphenoxy)acetyl]-1,3-thiazole-4-carboxylate |
| SMILES | COc1ccc(OCC(=O)c2nc(C(=O)[O-])cs2)cc1 |
| InChI | InChI=1S/C13H11NO5S/c1-18-8-2-4-9(5-3-8)19-6-11(15)12-14-10(7-20-12)13(16)17/h2-5,7H,6H2,1H3,(H,16,17)/p-1 |
| InChIKey | SSEBEVDLJPCOJP-UHFFFAOYSA-M |
| XLogP | 0.78 |
| TPSA | 88.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |