C15H14NO4S- — CID 9159320
2-[2-(2-propan-2-ylphenoxy)acetyl]-1,3-thiazole-4-carboxylate (PubChem CID 9159320) has the molecular formula C15H14NO4S- and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[2-(2-propan-2-ylphenoxy)acetyl]-1,3-thiazole-4-carboxylate.
| Compound Name | 2-[2-(2-propan-2-ylphenoxy)acetyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 9159320 |
| Molecular Formula | C15H14NO4S- |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[2-(2-propan-2-ylphenoxy)acetyl]-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)c1ccccc1OCC(=O)c1nc(C(=O)[O-])cs1 |
| InChI | InChI=1S/C15H15NO4S/c1-9(2)10-5-3-4-6-13(10)20-7-12(17)14-16-11(8-21-14)15(18)19/h3-6,8-9H,7H2,1-2H3,(H,18,19)/p-1 |
| InChIKey | LBGVIDBDZCLKHI-UHFFFAOYSA-M |
| XLogP | 1.89 |
| TPSA | 79.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |