2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid

C15H15NO5S — CID 9159640

IUPAC2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid
SMILESCCOc1ccccc1OCC(=O)c1nc(CC(=O)O)cs1
InChIInChI=1S/C15H15NO5S/c1-2-20-12-5-3-4-6-13(12)21-8-11(17)15-16-10(9-22-15)7-14(18)19/h3-6,9H,2,7-8H2,1H3,(H,18,19)
InChIKeyIRHZLQKFMQXFAI-UHFFFAOYSA-N
MW321.35 g/mol
LogP2.43
Rot. Bonds8

About 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid

2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 9159640) has the molecular formula C15H15NO5S and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid
PubChem CID9159640
Molecular FormulaC15H15NO5S
Molecular Weight321.35 g/mol
Exact Mass321.07
IUPAC Name2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid
SMILESCCOc1ccccc1OCC(=O)c1nc(CC(=O)O)cs1
InChIInChI=1S/C15H15NO5S/c1-2-20-12-5-3-4-6-13(12)21-8-11(17)15-16-10(9-22-15)7-14(18)19/h3-6,9H,2,7-8H2,1H3,(H,18,19)
InChIKeyIRHZLQKFMQXFAI-UHFFFAOYSA-N
XLogP2.43
TPSA85.72 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500321.35
LogP ≤ 52.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid (CID 9159640) is 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid is CCOc1ccccc1OCC(=O)c1nc(CC(=O)O)cs1.
What is the InChIKey of 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid?
The InChIKey is IRHZLQKFMQXFAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO5S/c1-2-20-12-5-3-4-6-13(12)21-8-11(17)15-16-10(9-22-15)7-14(18)19/h3-6,9H,2,7-8H2,1H3,(H,18,19).
What are the key properties of 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid?
2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid has a molecular weight of 321.35 g/mol, XLogP of 2.43, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 9159640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).