C15H15NO5S — CID 9159640
2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 9159640) has the molecular formula C15H15NO5S and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 9159640 |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-[2-[2-(2-ethoxyphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCOc1ccccc1OCC(=O)c1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C15H15NO5S/c1-2-20-12-5-3-4-6-13(12)21-8-11(17)15-16-10(9-22-15)7-14(18)19/h3-6,9H,2,7-8H2,1H3,(H,18,19) |
| InChIKey | IRHZLQKFMQXFAI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |