C19H22NO4S- — CID 9159576
2-[2-[2-(2-tert-butyl-4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetate (PubChem CID 9159576) has the molecular formula C19H22NO4S- and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[2-[2-(2-tert-butyl-4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-[2-(2-tert-butyl-4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 9159576 |
| Molecular Formula | C19H22NO4S- |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[2-[2-(2-tert-butyl-4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCc1ccc(OCC(=O)c2nc(CC(=O)[O-])cs2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H23NO4S/c1-5-12-6-7-16(14(8-12)19(2,3)4)24-10-15(21)18-20-13(11-25-18)9-17(22)23/h6-8,11H,5,9-10H2,1-4H3,(H,22,23)/p-1 |
| InChIKey | DPXOORVMKZPEFJ-UHFFFAOYSA-M |
| XLogP | 2.56 |
| TPSA | 79.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |