C15H15NO4S — CID 9159479
2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 9159479) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 9159479 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCc1ccc(OCC(=O)c2nc(CC(=O)O)cs2)cc1 |
| InChI | InChI=1S/C15H15NO4S/c1-2-10-3-5-12(6-4-10)20-8-13(17)15-16-11(9-21-15)7-14(18)19/h3-6,9H,2,7-8H2,1H3,(H,18,19) |
| InChIKey | YQUASJQSPBOGNY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |