2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid

C15H15NO4S — CID 9159479

IUPAC2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid
SMILESCCc1ccc(OCC(=O)c2nc(CC(=O)O)cs2)cc1
InChIInChI=1S/C15H15NO4S/c1-2-10-3-5-12(6-4-10)20-8-13(17)15-16-11(9-21-15)7-14(18)19/h3-6,9H,2,7-8H2,1H3,(H,18,19)
InChIKeyYQUASJQSPBOGNY-UHFFFAOYSA-N
MW305.36 g/mol
LogP2.59
Rot. Bonds7

About 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid

2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 9159479) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid
PubChem CID9159479
Molecular FormulaC15H15NO4S
Molecular Weight305.36 g/mol
Exact Mass305.07
IUPAC Name2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid
SMILESCCc1ccc(OCC(=O)c2nc(CC(=O)O)cs2)cc1
InChIInChI=1S/C15H15NO4S/c1-2-10-3-5-12(6-4-10)20-8-13(17)15-16-11(9-21-15)7-14(18)19/h3-6,9H,2,7-8H2,1H3,(H,18,19)
InChIKeyYQUASJQSPBOGNY-UHFFFAOYSA-N
XLogP2.59
TPSA76.49 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.36
LogP ≤ 52.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid (CID 9159479) is 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid is CCc1ccc(OCC(=O)c2nc(CC(=O)O)cs2)cc1.
What is the InChIKey of 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid?
The InChIKey is YQUASJQSPBOGNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO4S/c1-2-10-3-5-12(6-4-10)20-8-13(17)15-16-11(9-21-15)7-14(18)19/h3-6,9H,2,7-8H2,1H3,(H,18,19).
What are the key properties of 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid?
2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid has a molecular weight of 305.36 g/mol, XLogP of 2.59, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(4-ethylphenoxy)acetyl]-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 9159479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).