C10H13NO4S — CID 155133197
ethyl 2-[2-(2-methoxyacetyl)-1,3-thiazol-4-yl]acetate (PubChem CID 155133197) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is ethyl 2-[2-(2-methoxyacetyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(2-methoxyacetyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 155133197 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | ethyl 2-[2-(2-methoxyacetyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(C(=O)COC)n1 |
| InChI | InChI=1S/C10H13NO4S/c1-3-15-9(13)4-7-6-16-10(11-7)8(12)5-14-2/h6H,3-5H2,1-2H3 |
| InChIKey | VIRZEMNKLNOZAG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |