C10H16N2O2S — CID 107380027
ethyl 2-[2-(2-aminopropan-2-yl)-1,3-thiazol-4-yl]acetate (PubChem CID 107380027) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is ethyl 2-[2-(2-aminopropan-2-yl)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(2-aminopropan-2-yl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 107380027 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | ethyl 2-[2-(2-aminopropan-2-yl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(C(C)(C)N)n1 |
| InChI | InChI=1S/C10H16N2O2S/c1-4-14-8(13)5-7-6-15-9(12-7)10(2,3)11/h6H,4-5,11H2,1-3H3 |
| InChIKey | OANWJYJORYPSRR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |