C10H14BrNO2S — CID 129388879
ethyl (2R)-2-bromo-2-(4-ethyl-1,3-thiazol-2-yl)propanoate (PubChem CID 129388879) has the molecular formula C10H14BrNO2S and a molecular weight of 292.20 g/mol. Its IUPAC name is ethyl (2R)-2-bromo-2-(4-ethyl-1,3-thiazol-2-yl)propanoate.
| Compound Name | ethyl (2R)-2-bromo-2-(4-ethyl-1,3-thiazol-2-yl)propanoate |
|---|---|
| PubChem CID | 129388879 |
| Molecular Formula | C10H14BrNO2S |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | ethyl (2R)-2-bromo-2-(4-ethyl-1,3-thiazol-2-yl)propanoate |
| SMILES | CCOC(=O)[C@@](C)(Br)c1nc(CC)cs1 |
| InChI | InChI=1S/C10H14BrNO2S/c1-4-7-6-15-8(12-7)10(3,11)9(13)14-5-2/h6H,4-5H2,1-3H3/t10-/m0/s1 |
| InChIKey | CGYDULVGCWMZBR-JTQLQIEISA-N |
| XLogP | 2.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|