C10H15NO3S — CID 129388918
ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate (PubChem CID 129388918) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate.
| Compound Name | ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 129388918 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@](C)(O)c1nc(CC)cs1 |
| InChI | InChI=1S/C10H15NO3S/c1-4-7-6-15-8(11-7)10(3,13)9(12)14-5-2/h6,13H,4-5H2,1-3H3/t10-/m1/s1 |
| InChIKey | GGHJRUQXKJFCLW-SNVBAGLBSA-N |
| XLogP | 1.48 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |