About ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate
ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate (PubChem CID 129388918) has the molecular formula C10H15NO3S
and a molecular weight of 229.30 g/mol. Its IUPAC name is ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate |
| PubChem CID | 129388918 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@](C)(O)c1nc(CC)cs1 |
| InChI | InChI=1S/C10H15NO3S/c1-4-7-6-15-8(11-7)10(3,13)9(12)14-5-2/h6,13H,4-5H2,1-3H3/t10-/m1/s1 |
| InChIKey | GGHJRUQXKJFCLW-SNVBAGLBSA-N |
| XLogP | 1.48 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate?
The IUPAC name of ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate (CID 129388918) is ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate.
What is the SMILES notation for ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate?
The canonical SMILES for ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate is CCOC(=O)[C@](C)(O)c1nc(CC)cs1.
What is the InChIKey of ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate?
The InChIKey is GGHJRUQXKJFCLW-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H15NO3S/c1-4-7-6-15-8(11-7)10(3,13)9(12)14-5-2/h6,13H,4-5H2,1-3H3/t10-/m1/s1.
What are the key properties of ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate?
ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate has a molecular weight of 229.30 g/mol, XLogP of 1.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-hydroxypropanoate is sourced from PubChem (CID 129388918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).