C18H23N3O3S — CID 145341507
ethyl 3,3-dicyano-2-[4-(3-methoxy-2,2-dimethylbut-3-enyl)-1,3-thiazol-2-yl]-2-methylpropanoate (PubChem CID 145341507) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is ethyl 3,3-dicyano-2-[4-(3-methoxy-2,2-dimethylbut-3-enyl)-1,3-thiazol-2-yl]-2-methylpropanoate.
| Compound Name | ethyl 3,3-dicyano-2-[4-(3-methoxy-2,2-dimethylbut-3-enyl)-1,3-thiazol-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 145341507 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | ethyl 3,3-dicyano-2-[4-(3-methoxy-2,2-dimethylbut-3-enyl)-1,3-thiazol-2-yl]-2-methylpropanoate |
| SMILES | C=C(OC)C(C)(C)Cc1csc(C(C)(C(=O)OCC)C(C#N)C#N)n1 |
| InChI | InChI=1S/C18H23N3O3S/c1-7-24-16(22)18(5,13(9-19)10-20)15-21-14(11-25-15)8-17(3,4)12(2)23-6/h11,13H,2,7-8H2,1,3-6H3 |
| InChIKey | ZSGBUQRQMNYCKB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|