C10H12N2O2S — CID 103485638
3-[2-(2-cyanopropan-2-yl)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103485638) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-[2-(2-cyanopropan-2-yl)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(2-cyanopropan-2-yl)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103485638 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-[2-(2-cyanopropan-2-yl)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | CC(C)(C#N)c1nc(CCC(=O)O)cs1 |
| InChI | InChI=1S/C10H12N2O2S/c1-10(2,6-11)9-12-7(5-15-9)3-4-8(13)14/h5H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | JRTBBNMRLISGKJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |