C7H14O — CID 14453673
cis-(1R,2R)-2-butylcyclopropan-1-ol (PubChem CID 14453673) has the molecular formula C7H14O and a molecular weight of 114.19 g/mol. Its IUPAC name is cis-(1R,2R)-2-butylcyclopropan-1-ol.
| Compound Name | cis-(1R,2R)-2-butylcyclopropan-1-ol |
|---|---|
| PubChem CID | 14453673 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | cis-(1R,2R)-2-butylcyclopropan-1-ol |
| SMILES | CCCC[C@@H]1C[C@H]1O |
| InChI | InChI=1S/C7H14O/c1-2-3-4-6-5-7(6)8/h6-8H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | PFKHHAURVIJHMH-RNFRBKRXSA-N |
| XLogP | 1.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |