C14H28O — CID 71347162
3,4-dibutylcyclohexan-1-ol (PubChem CID 71347162) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is 3,4-dibutylcyclohexan-1-ol.
| Compound Name | 3,4-dibutylcyclohexan-1-ol |
|---|---|
| PubChem CID | 71347162 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 3,4-dibutylcyclohexan-1-ol |
| SMILES | CCCCC1CCC(O)CC1CCCC |
| InChI | InChI=1S/C14H28O/c1-3-5-7-12-9-10-14(15)11-13(12)8-6-4-2/h12-15H,3-11H2,1-2H3 |
| InChIKey | FERGJWFUAZRPMZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |