C12H24O — CID 58534220
4-butyl-2,3-dimethylcyclohexan-1-ol (PubChem CID 58534220) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is 4-butyl-2,3-dimethylcyclohexan-1-ol.
| Compound Name | 4-butyl-2,3-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 58534220 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 4-butyl-2,3-dimethylcyclohexan-1-ol |
| SMILES | CCCCC1CCC(O)C(C)C1C |
| InChI | InChI=1S/C12H24O/c1-4-5-6-11-7-8-12(13)10(3)9(11)2/h9-13H,4-8H2,1-3H3 |
| InChIKey | OBDVWHLFGXOOAK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |