C12H24 — CID 90887551
2-methyl-1,3-dipropylcyclopentane (PubChem CID 90887551) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is 2-methyl-1,3-dipropylcyclopentane.
| Compound Name | 2-methyl-1,3-dipropylcyclopentane |
|---|---|
| PubChem CID | 90887551 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | 2-methyl-1,3-dipropylcyclopentane |
| SMILES | CCCC1CCC(CCC)C1C |
| InChI | InChI=1S/C12H24/c1-4-6-11-8-9-12(7-5-2)10(11)3/h10-12H,4-9H2,1-3H3 |
| InChIKey | ZBMUJKQBKPWEBV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |