C12H24 — CID 168721749
(1R)-1-methyl-2,3-dipropylcyclopentane (PubChem CID 168721749) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is (1R)-1-methyl-2,3-dipropylcyclopentane.
| Compound Name | (1R)-1-methyl-2,3-dipropylcyclopentane |
|---|---|
| PubChem CID | 168721749 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | (1R)-1-methyl-2,3-dipropylcyclopentane |
| SMILES | CCCC1CC[C@@H](C)C1CCC |
| InChI | InChI=1S/C12H24/c1-4-6-11-9-8-10(3)12(11)7-5-2/h10-12H,4-9H2,1-3H3/t10-,11?,12?/m1/s1 |
| InChIKey | ARANNBGRAYVGKP-VOMCLLRMSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |