C18H32O4 — CID 151687641
4-[2-(3-carboxypropyl)-6-methyl-3-propylcyclohexyl]butanoic acid (PubChem CID 151687641) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is 4-[2-(3-carboxypropyl)-6-methyl-3-propylcyclohexyl]butanoic acid.
| Compound Name | 4-[2-(3-carboxypropyl)-6-methyl-3-propylcyclohexyl]butanoic acid |
|---|---|
| PubChem CID | 151687641 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 4-[2-(3-carboxypropyl)-6-methyl-3-propylcyclohexyl]butanoic acid |
| SMILES | CCCC1CCC(C)C(CCCC(=O)O)C1CCCC(=O)O |
| InChI | InChI=1S/C18H32O4/c1-3-6-14-12-11-13(2)15(7-4-9-17(19)20)16(14)8-5-10-18(21)22/h13-16H,3-12H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | RBWMUAZXGZCEHC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |