C13H24 — CID 167543521
1-ethyl-4-propyl-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 167543521) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 1-ethyl-4-propyl-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | 1-ethyl-4-propyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 167543521 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 1-ethyl-4-propyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | CCCC1CCC2C(CC)CCC12 |
| InChI | InChI=1S/C13H24/c1-3-5-11-7-9-12-10(4-2)6-8-13(11)12/h10-13H,3-9H2,1-2H3 |
| InChIKey | SFAKSJVEJJXYMP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |