C14H26 — CID 143342565
1-ethyl-5-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 143342565) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 1-ethyl-5-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 1-ethyl-5-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 143342565 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 1-ethyl-5-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CCCC1CCC2C(CC)CCC2C1 |
| InChI | InChI=1S/C14H26/c1-3-5-11-6-9-14-12(4-2)7-8-13(14)10-11/h11-14H,3-10H2,1-2H3 |
| InChIKey | WWGVNZLUDZNVRR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |