C28H60 — CID 160972744
1-ethyl-2,3-dimethyl-4-pentylcyclohexane;octane;pentane (PubChem CID 160972744) has the molecular formula C28H60 and a molecular weight of 396.79 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethyl-4-pentylcyclohexane;octane;pentane.
| Compound Name | 1-ethyl-2,3-dimethyl-4-pentylcyclohexane;octane;pentane |
|---|---|
| PubChem CID | 160972744 |
| Molecular Formula | C28H60 |
| Molecular Weight | 396.79 g/mol |
| Exact Mass | 396.47 |
| IUPAC Name | 1-ethyl-2,3-dimethyl-4-pentylcyclohexane;octane;pentane |
| SMILES | CCCCC.CCCCCC1CCC(CC)C(C)C1C.CCCCCCCC |
| InChI | InChI=1S/C15H30.C8H18.C5H12/c1-5-7-8-9-15-11-10-14(6-2)12(3)13(15)4;1-3-5-7-8-6-4-2;1-3-5-4-2/h12-15H,5-11H2,1-4H3;3-8H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | SYLXHDYQGUBXGY-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.79 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|