C6H11ClO — CID 129391118
trans-(1R,2S)-2-(3-chloropropyl)cyclopropan-1-ol (PubChem CID 129391118) has the molecular formula C6H11ClO and a molecular weight of 134.61 g/mol. Its IUPAC name is trans-(1R,2S)-2-(3-chloropropyl)cyclopropan-1-ol.
| Compound Name | trans-(1R,2S)-2-(3-chloropropyl)cyclopropan-1-ol |
|---|---|
| PubChem CID | 129391118 |
| Molecular Formula | C6H11ClO |
| Molecular Weight | 134.61 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | trans-(1R,2S)-2-(3-chloropropyl)cyclopropan-1-ol |
| SMILES | O[C@@H]1C[C@@H]1CCCCl |
| InChI | InChI=1S/C6H11ClO/c7-3-1-2-5-4-6(5)8/h5-6,8H,1-4H2/t5-,6+/m0/s1 |
| InChIKey | LWDSJSSAQHMGHA-NTSWFWBYSA-N |
| XLogP | 1.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.61 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|