C8H13Br2ClO — CID 70480385
2-[(1S,3R)-2,2-dibromo-3-(3-chloropropyl)cyclopropyl]ethanol (PubChem CID 70480385) has the molecular formula C8H13Br2ClO and a molecular weight of 320.45 g/mol. Its IUPAC name is 2-[(1S,3R)-2,2-dibromo-3-(3-chloropropyl)cyclopropyl]ethanol.
| Compound Name | 2-[(1S,3R)-2,2-dibromo-3-(3-chloropropyl)cyclopropyl]ethanol |
|---|---|
| PubChem CID | 70480385 |
| Molecular Formula | C8H13Br2ClO |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 317.90 |
| IUPAC Name | 2-[(1S,3R)-2,2-dibromo-3-(3-chloropropyl)cyclopropyl]ethanol |
| SMILES | OCC[C@H]1[C@@H](CCCCl)C1(Br)Br |
| InChI | InChI=1S/C8H13Br2ClO/c9-8(10)6(2-1-4-11)7(8)3-5-12/h6-7,12H,1-5H2/t6-,7+/m1/s1 |
| InChIKey | DTKIPOVPJOVPCS-RQJHMYQMSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|