C7H11Br2ClO — CID 70480900
[2,2-dibromo-3-(3-chloropropyl)cyclopropyl]methanol (PubChem CID 70480900) has the molecular formula C7H11Br2ClO and a molecular weight of 306.43 g/mol. Its IUPAC name is [2,2-dibromo-3-(3-chloropropyl)cyclopropyl]methanol.
| Compound Name | [2,2-dibromo-3-(3-chloropropyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 70480900 |
| Molecular Formula | C7H11Br2ClO |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 303.89 |
| IUPAC Name | [2,2-dibromo-3-(3-chloropropyl)cyclopropyl]methanol |
| SMILES | OCC1C(CCCCl)C1(Br)Br |
| InChI | InChI=1S/C7H11Br2ClO/c8-7(9)5(2-1-3-10)6(7)4-11/h5-6,11H,1-4H2 |
| InChIKey | FFKLKBJBSSXLKF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|