C12H17ClOS — CID 121002106
[(1R,2S)-2-(4-chlorobutyl)cyclopropyl]-thiophen-2-ylmethanol (PubChem CID 121002106) has the molecular formula C12H17ClOS and a molecular weight of 244.79 g/mol. Its IUPAC name is [(1R,2S)-2-(4-chlorobutyl)cyclopropyl]-thiophen-2-ylmethanol.
| Compound Name | [(1R,2S)-2-(4-chlorobutyl)cyclopropyl]-thiophen-2-ylmethanol |
|---|---|
| PubChem CID | 121002106 |
| Molecular Formula | C12H17ClOS |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | [(1R,2S)-2-(4-chlorobutyl)cyclopropyl]-thiophen-2-ylmethanol |
| SMILES | OC(c1cccs1)[C@@H]1C[C@@H]1CCCCCl |
| InChI | InChI=1S/C12H17ClOS/c13-6-2-1-4-9-8-10(9)12(14)11-5-3-7-15-11/h3,5,7,9-10,12,14H,1-2,4,6,8H2/t9-,10+,12?/m0/s1 |
| InChIKey | VMVQSUKHCSMWNB-YPBKCWQDSA-N |
| XLogP | 3.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|