C5H11NS — CID 55287644
(2S,4S)-2,4-dimethyl-1,3-thiazolidine (PubChem CID 55287644) has the molecular formula C5H11NS and a molecular weight of 117.22 g/mol. Its IUPAC name is (2S,4S)-2,4-dimethyl-1,3-thiazolidine.
| Compound Name | (2S,4S)-2,4-dimethyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 55287644 |
| Molecular Formula | C5H11NS |
| Molecular Weight | 117.22 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | (2S,4S)-2,4-dimethyl-1,3-thiazolidine |
| SMILES | C[C@H]1CS[C@@H](C)N1 |
| InChI | InChI=1S/C5H11NS/c1-4-3-7-5(2)6-4/h4-6H,3H2,1-2H3/t4-,5-/m0/s1 |
| InChIKey | FGBOEOZFZKNQAX-WHFBIAKZSA-N |
| XLogP | 1.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |