C5H10S — CID 130381786
(2R)-2,3-dimethylthietane (PubChem CID 130381786) has the molecular formula C5H10S and a molecular weight of 102.20 g/mol. Its IUPAC name is (2R)-2,3-dimethylthietane.
| Compound Name | (2R)-2,3-dimethylthietane |
|---|---|
| PubChem CID | 130381786 |
| Molecular Formula | C5H10S |
| Molecular Weight | 102.20 g/mol |
| Exact Mass | 102.05 |
| IUPAC Name | (2R)-2,3-dimethylthietane |
| SMILES | CC1CS[C@@H]1C |
| InChI | InChI=1S/C5H10S/c1-4-3-6-5(4)2/h4-5H,3H2,1-2H3/t4?,5-/m1/s1 |
| InChIKey | UOELDFAOGQTJNM-BRJRFNKRSA-N |
| XLogP | 1.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |