C6H12S — CID 170182644
(2R)-2,3-dimethylthiolane (PubChem CID 170182644) has the molecular formula C6H12S and a molecular weight of 116.23 g/mol. Its IUPAC name is (2R)-2,3-dimethylthiolane.
| Compound Name | (2R)-2,3-dimethylthiolane |
|---|---|
| PubChem CID | 170182644 |
| Molecular Formula | C6H12S |
| Molecular Weight | 116.23 g/mol |
| Exact Mass | 116.07 |
| IUPAC Name | (2R)-2,3-dimethylthiolane |
| SMILES | CC1CCS[C@@H]1C |
| InChI | InChI=1S/C6H12S/c1-5-3-4-7-6(5)2/h5-6H,3-4H2,1-2H3/t5?,6-/m1/s1 |
| InChIKey | PQAQKWCWCGKBDS-PRJDIBJQSA-N |
| XLogP | 2.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |