C12H23NS — CID 130948671
N-(2,3-dimethylcyclobutyl)-2-methylthian-3-amine (PubChem CID 130948671) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is N-(2,3-dimethylcyclobutyl)-2-methylthian-3-amine.
| Compound Name | N-(2,3-dimethylcyclobutyl)-2-methylthian-3-amine |
|---|---|
| PubChem CID | 130948671 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | N-(2,3-dimethylcyclobutyl)-2-methylthian-3-amine |
| SMILES | CC1CC(NC2CCCSC2C)C1C |
| InChI | InChI=1S/C12H23NS/c1-8-7-12(9(8)2)13-11-5-4-6-14-10(11)3/h8-13H,4-7H2,1-3H3 |
| InChIKey | ONYWFVWXHHAKMI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |