C11H21NO2S2 — CID 79957007
N-(1,1-dioxothian-4-yl)-2-methylthian-3-amine (PubChem CID 79957007) has the molecular formula C11H21NO2S2 and a molecular weight of 263.43 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-2-methylthian-3-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-2-methylthian-3-amine |
|---|---|
| PubChem CID | 79957007 |
| Molecular Formula | C11H21NO2S2 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-2-methylthian-3-amine |
| SMILES | CC1SCCCC1NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H21NO2S2/c1-9-11(3-2-6-15-9)12-10-4-7-16(13,14)8-5-10/h9-12H,2-8H2,1H3 |
| InChIKey | ZQJRQQLTEGKTEA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |