C16H30N2O2S — CID 107241652
tert-butyl 4-[(2-methylthian-3-yl)amino]piperidine-1-carboxylate (PubChem CID 107241652) has the molecular formula C16H30N2O2S and a molecular weight of 314.50 g/mol. Its IUPAC name is tert-butyl 4-[(2-methylthian-3-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-methylthian-3-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 107241652 |
| Molecular Formula | C16H30N2O2S |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | tert-butyl 4-[(2-methylthian-3-yl)amino]piperidine-1-carboxylate |
| SMILES | CC1SCCCC1NC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30N2O2S/c1-12-14(6-5-11-21-12)17-13-7-9-18(10-8-13)15(19)20-16(2,3)4/h12-14,17H,5-11H2,1-4H3 |
| InChIKey | GNBFWQOFGGSYIC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |