C18H31N3O2 — CID 143591944
tert-butyl 4-[[(2R)-2-(cyanomethyl)cyclohexyl]amino]piperidine-1-carboxylate (PubChem CID 143591944) has the molecular formula C18H31N3O2 and a molecular weight of 321.46 g/mol. Its IUPAC name is tert-butyl 4-[[(2R)-2-(cyanomethyl)cyclohexyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2R)-2-(cyanomethyl)cyclohexyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143591944 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | tert-butyl 4-[[(2R)-2-(cyanomethyl)cyclohexyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC2CCCC[C@@H]2CC#N)CC1 |
| InChI | InChI=1S/C18H31N3O2/c1-18(2,3)23-17(22)21-12-9-15(10-13-21)20-16-7-5-4-6-14(16)8-11-19/h14-16,20H,4-10,12-13H2,1-3H3/t14-,16?/m1/s1 |
| InChIKey | LVBSDRJKADJPQV-IURRXHLWSA-N |
| XLogP | 3.45 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |