C14H26N2O2S — CID 102672017
tert-butyl 3-[(2-methylthiolan-3-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 102672017) has the molecular formula C14H26N2O2S and a molecular weight of 286.44 g/mol. Its IUPAC name is tert-butyl 3-[(2-methylthiolan-3-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-methylthiolan-3-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102672017 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | tert-butyl 3-[(2-methylthiolan-3-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC1SCCC1NC1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H26N2O2S/c1-10-12(6-8-19-10)15-11-5-7-16(9-11)13(17)18-14(2,3)4/h10-12,15H,5-9H2,1-4H3 |
| InChIKey | JSMXJWKPTCPABL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |