C17H31N3O2 — CID 103820870
tert-butyl 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)pyrrolidine-1-carboxylate (PubChem CID 103820870) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is tert-butyl 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 103820870 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | tert-butyl 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC2CCN3CCCCC23)C1 |
| InChI | InChI=1S/C17H31N3O2/c1-17(2,3)22-16(21)20-10-7-13(12-20)18-14-8-11-19-9-5-4-6-15(14)19/h13-15,18H,4-12H2,1-3H3 |
| InChIKey | PYZHORAVBKZFML-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |