C12H23NO2S2 — CID 114122303
N-(2-methylsulfanylcyclohexyl)-1,1-dioxothian-4-amine (PubChem CID 114122303) has the molecular formula C12H23NO2S2 and a molecular weight of 277.45 g/mol. Its IUPAC name is N-(2-methylsulfanylcyclohexyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(2-methylsulfanylcyclohexyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 114122303 |
| Molecular Formula | C12H23NO2S2 |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(2-methylsulfanylcyclohexyl)-1,1-dioxothian-4-amine |
| SMILES | CSC1CCCCC1NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H23NO2S2/c1-16-12-5-3-2-4-11(12)13-10-6-8-17(14,15)9-7-10/h10-13H,2-9H2,1H3 |
| InChIKey | QINQPDVCQSBYAE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |