C7H11NOS — CID 91518906
4-methyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-2-one (PubChem CID 91518906) has the molecular formula C7H11NOS and a molecular weight of 157.24 g/mol. Its IUPAC name is 4-methyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-2-one.
| Compound Name | 4-methyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-2-one |
|---|---|
| PubChem CID | 91518906 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 4-methyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-2-one |
| SMILES | CC1SCC2NC(=O)CC21 |
| InChI | InChI=1S/C7H11NOS/c1-4-5-2-7(9)8-6(5)3-10-4/h4-6H,2-3H2,1H3,(H,8,9) |
| InChIKey | MEUKONVGOFLLBG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |