C8H16N2OS — CID 145181598
(3aS,6aR)-4-methyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;ethane (PubChem CID 145181598) has the molecular formula C8H16N2OS and a molecular weight of 188.30 g/mol. Its IUPAC name is (3aS,6aR)-4-methyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;ethane.
| Compound Name | (3aS,6aR)-4-methyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;ethane |
|---|---|
| PubChem CID | 145181598 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (3aS,6aR)-4-methyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;ethane |
| SMILES | CC.CC1SC[C@@H]2NC(=O)N[C@H]12 |
| InChI | InChI=1S/C6H10N2OS.C2H6/c1-3-5-4(2-10-3)7-6(9)8-5;1-2/h3-5H,2H2,1H3,(H2,7,8,9);1-2H3/t3?,4-,5+;/m0./s1 |
| InChIKey | CMQRHBYVSAUUDA-GGTNOVMKSA-N |
| XLogP | 1.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|