C8H14N2OS — CID 134331944
(3aS,6aR)-4-propan-2-yl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 134331944) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is (3aS,6aR)-4-propan-2-yl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,6aR)-4-propan-2-yl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 134331944 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | (3aS,6aR)-4-propan-2-yl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | CC(C)C1SC[C@@H]2NC(=O)N[C@H]12 |
| InChI | InChI=1S/C8H14N2OS/c1-4(2)7-6-5(3-12-7)9-8(11)10-6/h4-7H,3H2,1-2H3,(H2,9,10,11)/t5-,6-,7?/m0/s1 |
| InChIKey | LLSPLCBLLYDGJO-WABBHOIFSA-N |
| XLogP | 0.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|